C16H19N5O2 — CID 124956730
5-methyl-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]pyrazine-2-carboxamide (PubChem CID 124956730) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-methyl-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124956730 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-methyl-N-[[2-[(2S)-oxan-2-yl]pyrimidin-5-yl]methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCc2cnc([C@@H]3CCCCO3)nc2)cn1 |
| InChI | InChI=1S/C16H19N5O2/c1-11-6-18-13(10-17-11)16(22)21-9-12-7-19-15(20-8-12)14-4-2-3-5-23-14/h6-8,10,14H,2-5,9H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | FTUFZWOXPRWKEA-AWEZNQCLSA-N |
| XLogP | 1.75 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |