C15H16O4S — CID 11011786
(3R,3aR,7aR)-1,1-dioxo-3-phenylmethoxy-3,3a,4,7a-tetrahydro-2H-1-benzothiophen-5-one (PubChem CID 11011786) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is (3R,3aR,7aR)-1,1-dioxo-3-phenylmethoxy-3,3a,4,7a-tetrahydro-2H-1-benzothiophen-5-one.
| Compound Name | (3R,3aR,7aR)-1,1-dioxo-3-phenylmethoxy-3,3a,4,7a-tetrahydro-2H-1-benzothiophen-5-one |
|---|---|
| PubChem CID | 11011786 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (3R,3aR,7aR)-1,1-dioxo-3-phenylmethoxy-3,3a,4,7a-tetrahydro-2H-1-benzothiophen-5-one |
| SMILES | O=C1C=C[C@@H]2[C@H](C1)[C@@H](OCc1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C15H16O4S/c16-12-6-7-15-13(8-12)14(10-20(15,17)18)19-9-11-4-2-1-3-5-11/h1-7,13-15H,8-10H2/t13-,14+,15-/m1/s1 |
| InChIKey | WPOOONGUNIWHDE-QLFBSQMISA-N |
| XLogP | 1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |