C16H8ClNO3 — CID 11011944
5-(4-chlorophenyl)-3H-cyclopenta[f][1,3]benzoxazole-2,7-dione (PubChem CID 11011944) has the molecular formula C16H8ClNO3 and a molecular weight of 297.70 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3H-cyclopenta[f][1,3]benzoxazole-2,7-dione.
| Compound Name | 5-(4-chlorophenyl)-3H-cyclopenta[f][1,3]benzoxazole-2,7-dione |
|---|---|
| PubChem CID | 11011944 |
| Molecular Formula | C16H8ClNO3 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 5-(4-chlorophenyl)-3H-cyclopenta[f][1,3]benzoxazole-2,7-dione |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)c2cc3[nH]c(=O)oc3cc21 |
| InChI | InChI=1S/C16H8ClNO3/c17-9-3-1-8(2-4-9)10-6-14(19)12-7-15-13(5-11(10)12)18-16(20)21-15/h1-7H,(H,18,20) |
| InChIKey | ADGXYANHVQYBOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |