C7H4ClNO3 — CID 171035252
5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one (PubChem CID 171035252) has the molecular formula C7H4ClNO3 and a molecular weight of 186.56 g/mol. Its IUPAC name is 5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 171035252 |
| Molecular Formula | C7H4ClNO3 |
| Molecular Weight | 186.56 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 5-chloro-6-hydroxy-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[15nH]c2cc(Cl)c(O)cc2o1 |
| InChI | InChI=1S/C7H4ClNO3/c8-3-1-4-6(2-5(3)10)12-7(11)9-4/h1-2,10H,(H,9,11)/i9+1 |
| InChIKey | AGLXDWOTVQZHIQ-QBZHADDCSA-N |
| XLogP | 1.48 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |