C17H24O5 — CID 11012276
ethyl (1S,4S,9R)-11,11-dimethyl-5-oxo-10,12-dioxatetracyclo[5.5.1.13,9.01,9]tetradecane-4-carboxylate (PubChem CID 11012276) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is ethyl (1S,4S,9R)-11,11-dimethyl-5-oxo-10,12-dioxatetracyclo[5.5.1.13,9.01,9]tetradecane-4-carboxylate.
| Compound Name | ethyl (1S,4S,9R)-11,11-dimethyl-5-oxo-10,12-dioxatetracyclo[5.5.1.13,9.01,9]tetradecane-4-carboxylate |
|---|---|
| PubChem CID | 11012276 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | ethyl (1S,4S,9R)-11,11-dimethyl-5-oxo-10,12-dioxatetracyclo[5.5.1.13,9.01,9]tetradecane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)CC2C[C@@]34CC1C[C@]3(C2)OC(C)(C)O4 |
| InChI | InChI=1S/C17H24O5/c1-4-20-14(19)13-11-8-16-6-10(5-12(13)18)7-17(16,9-11)22-15(2,3)21-16/h10-11,13H,4-9H2,1-3H3/t10?,11?,13-,16-,17+/m0/s1 |
| InChIKey | BWBMUAIJJUEWDN-KSVHSXILSA-N |
| XLogP | 2.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|