C16H20N6O2 — CID 110123469
N-[(3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl)methyl]-N-methylpyrimidine-5-carboxamide (PubChem CID 110123469) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[(3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl)methyl]-N-methylpyrimidine-5-carboxamide.
| Compound Name | N-[(3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl)methyl]-N-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110123469 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl)methyl]-N-methylpyrimidine-5-carboxamide |
| SMILES | CN(CC1(O)CCCN(c2cnccn2)C1)C(=O)c1cncnc1 |
| InChI | InChI=1S/C16H20N6O2/c1-21(15(23)13-7-18-12-19-8-13)10-16(24)3-2-6-22(11-16)14-9-17-4-5-20-14/h4-5,7-9,12,24H,2-3,6,10-11H2,1H3 |
| InChIKey | IKKYQQYZMCFLSG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |