C20H26N4O2 — CID 124960899
4-ethyl-N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylbenzamide (PubChem CID 124960899) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-ethyl-N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-ethyl-N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 124960899 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-ethyl-N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylbenzamide |
| SMILES | CCc1ccc(C(=O)N(C)C[C@@]2(O)CCCN(c3cnccn3)C2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-3-16-5-7-17(8-6-16)19(25)23(2)14-20(26)9-4-12-24(15-20)18-13-21-10-11-22-18/h5-8,10-11,13,26H,3-4,9,12,14-15H2,1-2H3/t20-/m0/s1 |
| InChIKey | GXTAOKQSAWFFFB-FQEVSTJZSA-N |
| XLogP | 2.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |