C16H20N4O2S — CID 124984347
N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylthiophene-3-carboxamide (PubChem CID 124984347) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylthiophene-3-carboxamide.
| Compound Name | N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 124984347 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methylthiophene-3-carboxamide |
| SMILES | CN(C[C@]1(O)CCCN(c2cnccn2)C1)C(=O)c1ccsc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-19(15(21)13-3-8-23-10-13)11-16(22)4-2-7-20(12-16)14-9-17-5-6-18-14/h3,5-6,8-10,22H,2,4,7,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | NKBXCCACQAQSSD-MRXNPFEDSA-N |
| XLogP | 1.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |