C18H23N5O2 — CID 124991776
N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-2-pyridin-3-ylacetamide (PubChem CID 124991776) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-2-pyridin-3-ylacetamide.
| Compound Name | N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 124991776 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-2-pyridin-3-ylacetamide |
| SMILES | CN(C[C@@]1(O)CCCN(c2cnccn2)C1)C(=O)Cc1cccnc1 |
| InChI | InChI=1S/C18H23N5O2/c1-22(17(24)10-15-4-2-6-19-11-15)13-18(25)5-3-9-23(14-18)16-12-20-7-8-21-16/h2,4,6-8,11-12,25H,3,5,9-10,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | PLQYXDFIIKPTMU-SFHVURJKSA-N |
| XLogP | 0.90 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |