C18H26N6O2 — CID 124972319
N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-4-pyrazol-1-ylbutanamide (PubChem CID 124972319) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-4-pyrazol-1-ylbutanamide.
| Compound Name | N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-4-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 124972319 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | N-[[(3S)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methyl]-N-methyl-4-pyrazol-1-ylbutanamide |
| SMILES | CN(C[C@]1(O)CCCN(c2cnccn2)C1)C(=O)CCCn1cccn1 |
| InChI | InChI=1S/C18H26N6O2/c1-22(17(25)5-2-11-24-12-4-7-21-24)14-18(26)6-3-10-23(15-18)16-13-19-8-9-20-16/h4,7-9,12-13,26H,2-3,5-6,10-11,14-15H2,1H3/t18-/m1/s1 |
| InChIKey | KCGZIPMPMVSVCR-GOSISDBHSA-N |
| XLogP | 0.94 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |