C19H22N2O2 — CID 11012352
(13R,15R,16S,19R)-13-ethyl-16-hydroxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one (PubChem CID 11012352) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (13R,15R,16S,19R)-13-ethyl-16-hydroxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one.
| Compound Name | (13R,15R,16S,19R)-13-ethyl-16-hydroxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
|---|---|
| PubChem CID | 11012352 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (13R,15R,16S,19R)-13-ethyl-16-hydroxy-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
| SMILES | CC[C@@H]1C[C@H]2[C@H](O)C(=O)n3c4c(c5ccccc53)CCN(C1)[C@@H]42 |
| InChI | InChI=1S/C19H22N2O2/c1-2-11-9-14-16-17-13(7-8-20(16)10-11)12-5-3-4-6-15(12)21(17)19(23)18(14)22/h3-6,11,14,16,18,22H,2,7-10H2,1H3/t11-,14-,16-,18+/m1/s1 |
| InChIKey | CFGWIGBXBJVRDV-FJQTWTKGSA-N |
| XLogP | 2.60 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |