C17H27N3O2S — CID 110124776
(5aS,9aR)-1-(2-methoxyethyl)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one (PubChem CID 110124776) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is (5aS,9aR)-1-(2-methoxyethyl)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one.
| Compound Name | (5aS,9aR)-1-(2-methoxyethyl)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
|---|---|
| PubChem CID | 110124776 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (5aS,9aR)-1-(2-methoxyethyl)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4,5,5a,6,8,9,9a-octahydropyrido[4,3-b]azepin-2-one |
| SMILES | COCCN1C(=O)CCC[C@H]2CN(Cc3scnc3C)CC[C@H]21 |
| InChI | InChI=1S/C17H27N3O2S/c1-13-16(23-12-18-13)11-19-7-6-15-14(10-19)4-3-5-17(21)20(15)8-9-22-2/h12,14-15H,3-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | VQKTXMNGUONUSV-LSDHHAIUSA-N |
| XLogP | 2.30 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |