C17H28N2O3 — CID 110126237
1-[2-[(3aS,5R,7aR)-5-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-oxoethyl]azepan-2-one (PubChem CID 110126237) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[2-[(3aS,5R,7aR)-5-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-oxoethyl]azepan-2-one.
| Compound Name | 1-[2-[(3aS,5R,7aR)-5-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-oxoethyl]azepan-2-one |
|---|---|
| PubChem CID | 110126237 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[2-[(3aS,5R,7aR)-5-hydroxy-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-oxoethyl]azepan-2-one |
| SMILES | C[C@@]12CCN(C(=O)CN3CCCCCC3=O)[C@@H]1CC[C@@H](O)C2 |
| InChI | InChI=1S/C17H28N2O3/c1-17-8-10-19(14(17)7-6-13(20)11-17)16(22)12-18-9-4-2-3-5-15(18)21/h13-14,20H,2-12H2,1H3/t13-,14-,17+/m1/s1 |
| InChIKey | MCVBQCULYJVSLU-CPUCHLNUSA-N |
| XLogP | 1.54 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |