C19H26N2O4 — CID 110127009
3-[[(4aS,9aS)-3-oxo-4-propan-2-yl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzoic acid (PubChem CID 110127009) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-[[(4aS,9aS)-3-oxo-4-propan-2-yl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzoic acid.
| Compound Name | 3-[[(4aS,9aS)-3-oxo-4-propan-2-yl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 110127009 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-[[(4aS,9aS)-3-oxo-4-propan-2-yl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]benzoic acid |
| SMILES | CC(C)N1C(=O)CO[C@H]2CCN(Cc3cccc(C(=O)O)c3)CC[C@@H]21 |
| InChI | InChI=1S/C19H26N2O4/c1-13(2)21-16-6-8-20(9-7-17(16)25-12-18(21)22)11-14-4-3-5-15(10-14)19(23)24/h3-5,10,13,16-17H,6-9,11-12H2,1-2H3,(H,23,24)/t16-,17-/m0/s1 |
| InChIKey | HSPXCUQLLVKRHT-IRXDYDNUSA-N |
| XLogP | 1.99 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |