C18H25FN2O2 — CID 110128189
4-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]benzamide (PubChem CID 110128189) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]benzamide.
| Compound Name | 4-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]benzamide |
|---|---|
| PubChem CID | 110128189 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H](N2CCCC2)[C@@H]1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN2O2/c19-14-9-7-13(8-10-14)18(23)20-15-5-1-2-6-16(17(15)22)21-11-3-4-12-21/h7-10,15-17,22H,1-6,11-12H2,(H,20,23)/t15-,16-,17-/m1/s1 |
| InChIKey | FVZZIGZXFFAZPM-BRWVUGGUSA-N |
| XLogP | 2.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |