C21H27N3O2 — CID 110128202
N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]quinoline-6-carboxamide (PubChem CID 110128202) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]quinoline-6-carboxamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 110128202 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-pyrrolidin-1-ylcycloheptyl]quinoline-6-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H](N2CCCC2)[C@@H]1O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H27N3O2/c25-20-18(7-1-2-8-19(20)24-12-3-4-13-24)23-21(26)16-9-10-17-15(14-16)6-5-11-22-17/h5-6,9-11,14,18-20,25H,1-4,7-8,12-13H2,(H,23,26)/t18-,19-,20-/m1/s1 |
| InChIKey | FZGHMIJZMVQRFC-VAMGGRTRSA-N |
| XLogP | 2.73 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |