About N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide
N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 110130360) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide |
| PubChem CID | 110130360 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CC(=O)NC1CNC2(CCN(C(=O)c3ccccc3-c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H27N3O2/c1-17(27)25-19-15-23(24-16-19)11-13-26(14-12-23)22(28)21-10-6-5-9-20(21)18-7-3-2-4-8-18/h2-10,19,24H,11-16H2,1H3,(H,25,27) |
| InChIKey | NALUVFCXAPJDGX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide?
The IUPAC name of N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide (CID 110130360) is N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide.
What is the SMILES notation for N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide?
The canonical SMILES for N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide is CC(=O)NC1CNC2(CCN(C(=O)c3ccccc3-c3ccccc3)CC2)C1.
What is the InChIKey of N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide?
The InChIKey is NALUVFCXAPJDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-17(27)25-19-15-23(24-16-19)11-13-26(14-12-23)22(28)21-10-6-5-9-20(21)18-7-3-2-4-8-18/h2-10,19,24H,11-16H2,1H3,(H,25,27).
What are the key properties of N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide?
N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide has a molecular weight of 377.49 g/mol, XLogP of 2.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[8-(2-phenylbenzoyl)-1,8-diazaspiro[4.5]decan-3-yl]acetamide is sourced from PubChem (CID 110130360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).