C20H27NO4 — CID 110134132
benzyl (2S,3'R,3aR,7aR)-3'-hydroxyspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate (PubChem CID 110134132) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is benzyl (2S,3'R,3aR,7aR)-3'-hydroxyspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate.
| Compound Name | benzyl (2S,3'R,3aR,7aR)-3'-hydroxyspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 110134132 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | benzyl (2S,3'R,3aR,7aR)-3'-hydroxyspiro[3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2,4'-piperidine]-1'-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@]2(C[C@H]3CCCC[C@H]3O2)[C@H](O)C1 |
| InChI | InChI=1S/C20H27NO4/c22-18-13-21(19(23)24-14-15-6-2-1-3-7-15)11-10-20(18)12-16-8-4-5-9-17(16)25-20/h1-3,6-7,16-18,22H,4-5,8-14H2/t16-,17-,18-,20-/m1/s1 |
| InChIKey | QBTBPCZVVBBANQ-SOAMZJECSA-N |
| XLogP | 3.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |