C12H5BrF5NO — CID 11013643
(2E)-2-[(4-bromophenyl)methylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile (PubChem CID 11013643) has the molecular formula C12H5BrF5NO and a molecular weight of 354.07 g/mol. Its IUPAC name is (2E)-2-[(4-bromophenyl)methylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile.
| Compound Name | (2E)-2-[(4-bromophenyl)methylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile |
|---|---|
| PubChem CID | 11013643 |
| Molecular Formula | C12H5BrF5NO |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | (2E)-2-[(4-bromophenyl)methylidene]-4,4,5,5,5-pentafluoro-3-oxopentanenitrile |
| SMILES | N#C/C(=C\c1ccc(Br)cc1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5BrF5NO/c13-9-3-1-7(2-4-9)5-8(6-19)10(20)11(14,15)12(16,17)18/h1-5H/b8-5+ |
| InChIKey | OWBNYBWRAAZQOC-VMPITWQZSA-N |
| XLogP | 4.12 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|