C22H27F3N4O — CID 110136572
(2S,3aS,9aS)-3a-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one (PubChem CID 110136572) has the molecular formula C22H27F3N4O and a molecular weight of 420.48 g/mol. Its IUPAC name is (2S,3aS,9aS)-3a-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one.
| Compound Name | (2S,3aS,9aS)-3a-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110136572 |
| Molecular Formula | C22H27F3N4O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (2S,3aS,9aS)-3a-methyl-1-[(1-methylpyrazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenyl]-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
| SMILES | Cn1cc(CN2[C@H]3CCCCC(=O)N[C@@]3(C)C[C@H]2c2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C22H27F3N4O/c1-21-11-18(16-6-5-7-17(10-16)22(23,24)25)29(14-15-12-26-28(2)13-15)19(21)8-3-4-9-20(30)27-21/h5-7,10,12-13,18-19H,3-4,8-9,11,14H2,1-2H3,(H,27,30)/t18-,19-,21-/m0/s1 |
| InChIKey | FAFAIYJJSVTIDR-ZJOUEHCJSA-N |
| XLogP | 4.20 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |