C19H24FN3O3 — CID 110136970
N-[(3aS,7aS)-2-acetyl-5-[2-(4-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide (PubChem CID 110136970) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[(3aS,7aS)-2-acetyl-5-[2-(4-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide.
| Compound Name | N-[(3aS,7aS)-2-acetyl-5-[2-(4-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide |
|---|---|
| PubChem CID | 110136970 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(3aS,7aS)-2-acetyl-5-[2-(4-fluorophenyl)acetyl]-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-7a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CCN(C(=O)Cc3ccc(F)cc3)C[C@@H]1CN(C(C)=O)C2 |
| InChI | InChI=1S/C19H24FN3O3/c1-13(24)21-19-7-8-22(10-16(19)11-23(12-19)14(2)25)18(26)9-15-3-5-17(20)6-4-15/h3-6,16H,7-12H2,1-2H3,(H,21,24)/t16-,19-/m1/s1 |
| InChIKey | HPMDWQNWDMGZFJ-VQIMIIECSA-N |
| XLogP | 0.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |