C24H29N3O2 — CID 110138093
(2R,3aS,9aS)-2-benzyl-3a-methyl-1-(2-pyridin-3-ylacetyl)-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one (PubChem CID 110138093) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (2R,3aS,9aS)-2-benzyl-3a-methyl-1-(2-pyridin-3-ylacetyl)-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one.
| Compound Name | (2R,3aS,9aS)-2-benzyl-3a-methyl-1-(2-pyridin-3-ylacetyl)-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 110138093 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (2R,3aS,9aS)-2-benzyl-3a-methyl-1-(2-pyridin-3-ylacetyl)-2,3,4,6,7,8,9,9a-octahydropyrrolo[3,2-b]azocin-5-one |
| SMILES | C[C@]12C[C@@H](Cc3ccccc3)N(C(=O)Cc3cccnc3)[C@H]1CCCCC(=O)N2 |
| InChI | InChI=1S/C24H29N3O2/c1-24-16-20(14-18-8-3-2-4-9-18)27(21(24)11-5-6-12-22(28)26-24)23(29)15-19-10-7-13-25-17-19/h2-4,7-10,13,17,20-21H,5-6,11-12,14-16H2,1H3,(H,26,28)/t20-,21+,24+/m1/s1 |
| InChIKey | GKOVLDCNCPWRCS-DPLHUUCSSA-N |
| XLogP | 3.29 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |