C25H30ClN3O2 — CID 155984545
2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 155984545) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is 2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 155984545 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | C[C@]12C[C@@H](Cc3ccccc3)N(CC(=O)NCc3ccccc3Cl)[C@H]1CCCC(=O)N2 |
| InChI | InChI=1S/C25H30ClN3O2/c1-25-15-20(14-18-8-3-2-4-9-18)29(22(25)12-7-13-23(30)28-25)17-24(31)27-16-19-10-5-6-11-21(19)26/h2-6,8-11,20,22H,7,12-17H2,1H3,(H,27,31)(H,28,30)/t20-,22+,25+/m1/s1 |
| InChIKey | AZXZLHQUNCRMRJ-KJWPAHLWSA-N |
| XLogP | 3.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |