C25H30N6O4 — CID 110152892
7-[2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-2-oxoethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110152892) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 7-[2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-2-oxoethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110152892 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 7-[2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-2-oxoethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)N2[C@H](Cc3ccccc3)C[C@]3(C)NC(=O)CCC[C@H]23)n(C)c1=O |
| InChI | InChI=1S/C25H30N6O4/c1-25-13-17(12-16-8-5-4-6-9-16)31(18(25)10-7-11-19(32)27-25)20(33)14-30-15-26-22-21(30)23(34)29(3)24(35)28(22)2/h4-6,8-9,15,17-18H,7,10-14H2,1-3H3,(H,27,32)/t17-,18+,25+/m1/s1 |
| InChIKey | HQKPFUJNPGUSED-UZEJHQAJSA-N |
| XLogP | 0.70 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |