C16H27N5O2S — CID 110138938
(3aR,4R,6aS)-N,N-diethyl-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide (PubChem CID 110138938) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is (3aR,4R,6aS)-N,N-diethyl-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide.
| Compound Name | (3aR,4R,6aS)-N,N-diethyl-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide |
|---|---|
| PubChem CID | 110138938 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (3aR,4R,6aS)-N,N-diethyl-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1C[C@H]2CC[C@@H](N(C)c3cnccn3)[C@H]2C1 |
| InChI | InChI=1S/C16H27N5O2S/c1-4-20(5-2)24(22,23)21-11-13-6-7-15(14(13)12-21)19(3)16-10-17-8-9-18-16/h8-10,13-15H,4-7,11-12H2,1-3H3/t13-,14+,15-/m1/s1 |
| InChIKey | ZFRMKFYIIBNQAV-QLFBSQMISA-N |
| XLogP | 1.21 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |