C17H22N6OS — CID 110139014
[(3aR,4R,6aS)-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-ethylthiadiazol-5-yl)methanone (PubChem CID 110139014) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-ethylthiadiazol-5-yl)methanone.
| Compound Name | [(3aR,4R,6aS)-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-ethylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 110139014 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [(3aR,4R,6aS)-4-[methyl(pyrazin-2-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-(4-ethylthiadiazol-5-yl)methanone |
| SMILES | CCc1nnsc1C(=O)N1C[C@H]2CC[C@@H](N(C)c3cnccn3)[C@H]2C1 |
| InChI | InChI=1S/C17H22N6OS/c1-3-13-16(25-21-20-13)17(24)23-9-11-4-5-14(12(11)10-23)22(2)15-8-18-6-7-19-15/h6-8,11-12,14H,3-5,9-10H2,1-2H3/t11-,12+,14-/m1/s1 |
| InChIKey | JKHRRUHTZYQHGP-MBNYWOFBSA-N |
| XLogP | 1.88 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |