C18H22FN5 — CID 110138903
(3aR,4R,6aS)-2-[(3-fluoro-2-pyridinyl)methyl]-N-methyl-N-pyrazin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 110138903) has the molecular formula C18H22FN5 and a molecular weight of 327.41 g/mol. Its IUPAC name is (3aR,4R,6aS)-2-[(3-fluoro-2-pyridinyl)methyl]-N-methyl-N-pyrazin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4R,6aS)-2-[(3-fluoro-2-pyridinyl)methyl]-N-methyl-N-pyrazin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 110138903 |
| Molecular Formula | C18H22FN5 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (3aR,4R,6aS)-2-[(3-fluoro-2-pyridinyl)methyl]-N-methyl-N-pyrazin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | CN(c1cnccn1)[C@@H]1CC[C@@H]2CN(Cc3ncccc3F)C[C@@H]21 |
| InChI | InChI=1S/C18H22FN5/c1-23(18-9-20-7-8-22-18)17-5-4-13-10-24(11-14(13)17)12-16-15(19)3-2-6-21-16/h2-3,6-9,13-14,17H,4-5,10-12H2,1H3/t13-,14+,17-/m1/s1 |
| InChIKey | ILFSVDFPEMDTGO-JKIFEVAISA-N |
| XLogP | 2.36 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |