C16H20N6 — CID 110139117
(3aR,4R,6aS)-N-methyl-N-pyridazin-3-yl-2-pyrimidin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 110139117) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is (3aR,4R,6aS)-N-methyl-N-pyridazin-3-yl-2-pyrimidin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4R,6aS)-N-methyl-N-pyridazin-3-yl-2-pyrimidin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 110139117 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | (3aR,4R,6aS)-N-methyl-N-pyridazin-3-yl-2-pyrimidin-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | CN(c1cccnn1)[C@@H]1CC[C@@H]2CN(c3ncccn3)C[C@@H]21 |
| InChI | InChI=1S/C16H20N6/c1-21(15-4-2-9-19-20-15)14-6-5-12-10-22(11-13(12)14)16-17-7-3-8-18-16/h2-4,7-9,12-14H,5-6,10-11H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | NSZSVXZBJWECHG-HZSPNIEDSA-N |
| XLogP | 1.62 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |