C15H26N4O2S — CID 110140359
(4aS,9aS)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepine (PubChem CID 110140359) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is (4aS,9aS)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepine.
| Compound Name | (4aS,9aS)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepine |
|---|---|
| PubChem CID | 110140359 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (4aS,9aS)-1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4a-methyl-3,4,5,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepine |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCC[C@]2(C)NCCCC[C@H]12 |
| InChI | InChI=1S/C15H26N4O2S/c1-12-13(11-18(3)17-12)22(20,21)19-10-6-8-15(2)14(19)7-4-5-9-16-15/h11,14,16H,4-10H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | ZMRAAWXVVOETQE-GJZGRUSLSA-N |
| XLogP | 1.41 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |