C18H25N3O3S — CID 95706787
4-[2-[(2R)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethyl]phenol (PubChem CID 95706787) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-[2-[(2R)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethyl]phenol.
| Compound Name | 4-[2-[(2R)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethyl]phenol |
|---|---|
| PubChem CID | 95706787 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[2-[(2R)-1-(1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]ethyl]phenol |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCCC[C@@H]1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-14-18(13-20(2)19-14)25(23,24)21-12-4-3-5-16(21)9-6-15-7-10-17(22)11-8-15/h7-8,10-11,13,16,22H,3-6,9,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | IVRKMXJXTUCTTI-MRXNPFEDSA-N |
| XLogP | 2.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |