C21H26N4OS — CID 110140441
[(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]methanone (PubChem CID 110140441) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is [(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]methanone.
| Compound Name | [(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 110140441 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-[6-(4-methyl-1,3-thiazol-5-yl)-3-pyridinyl]methanone |
| SMILES | Cc1ncsc1-c1ccc(C(=O)N2[C@@H]3CN[C@@H]4CCCC[C@H]2[C@]4(C)C3)cn1 |
| InChI | InChI=1S/C21H26N4OS/c1-13-19(27-12-24-13)16-8-7-14(10-22-16)20(26)25-15-9-21(2)17(23-11-15)5-3-4-6-18(21)25/h7-8,10,12,15,17-18,23H,3-6,9,11H2,1-2H3/t15-,17+,18-,21+/m0/s1 |
| InChIKey | OYCRLLZYQDNLJG-CQSHLORDSA-N |
| XLogP | 3.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |