C26H26FN5O2 — CID 110151827
5-(4-fluorophenyl)-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 110151827) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | 5-(4-fluorophenyl)-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 110151827 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 5-(4-fluorophenyl)-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cccc(Nc4ncccn4)c3)CC2)C(c2ccc(F)cc2)CN1 |
| InChI | InChI=1S/C26H26FN5O2/c27-20-7-5-18(6-8-20)22-17-30-23(33)16-26(22)9-13-32(14-10-26)24(34)19-3-1-4-21(15-19)31-25-28-11-2-12-29-25/h1-8,11-12,15,22H,9-10,13-14,16-17H2,(H,30,33)(H,28,29,31) |
| InChIKey | UDRPZVAGNKMIQV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |