C25H26N4O3 — CID 110149617
(3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-[3-(pyrimidin-2-ylamino)phenyl]methanone (PubChem CID 110149617) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is (3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-[3-(pyrimidin-2-ylamino)phenyl]methanone.
| Compound Name | (3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-[3-(pyrimidin-2-ylamino)phenyl]methanone |
|---|---|
| PubChem CID | 110149617 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (3-phenoxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-[3-(pyrimidin-2-ylamino)phenyl]methanone |
| SMILES | O=C(c1cccc(Nc2ncccn2)c1)N1CCC2(CC1)CC(Oc1ccccc1)CO2 |
| InChI | InChI=1S/C25H26N4O3/c30-23(19-6-4-7-20(16-19)28-24-26-12-5-13-27-24)29-14-10-25(11-15-29)17-22(18-31-25)32-21-8-2-1-3-9-21/h1-9,12-13,16,22H,10-11,14-15,17-18H2,(H,26,27,28) |
| InChIKey | RTIMOIZHWOJUFC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |