C26H27N5O2 — CID 125015746
(5R)-5-phenyl-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 125015746) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is (5R)-5-phenyl-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | (5R)-5-phenyl-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 125015746 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (5R)-5-phenyl-9-[3-(pyrimidin-2-ylamino)benzoyl]-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | O=C1CC2(CCN(C(=O)c3cccc(Nc4ncccn4)c3)CC2)[C@H](c2ccccc2)CN1 |
| InChI | InChI=1S/C26H27N5O2/c32-23-17-26(22(18-29-23)19-6-2-1-3-7-19)10-14-31(15-11-26)24(33)20-8-4-9-21(16-20)30-25-27-12-5-13-28-25/h1-9,12-13,16,22H,10-11,14-15,17-18H2,(H,29,32)(H,27,28,30)/t22-/m0/s1 |
| InChIKey | WVWUYUBCBDCSBW-QFIPXVFZSA-N |
| XLogP | 3.75 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |