C28H36N4O3 — CID 110152345
2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 110152345) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 110152345 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 2-[(2R,3aS,8aS)-2-benzyl-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | C[C@]12C[C@@H](Cc3ccccc3)N(CC(=O)Nc3ccc(N4CCOCC4)cc3)[C@H]1CCCC(=O)N2 |
| InChI | InChI=1S/C28H36N4O3/c1-28-19-24(18-21-6-3-2-4-7-21)32(25(28)8-5-9-26(33)30-28)20-27(34)29-22-10-12-23(13-11-22)31-14-16-35-17-15-31/h2-4,6-7,10-13,24-25H,5,8-9,14-20H2,1H3,(H,29,34)(H,30,33)/t24-,25+,28+/m1/s1 |
| InChIKey | SRASPPULJOBXPI-QQNWGBJXSA-N |
| XLogP | 3.21 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|