C22H33NO4 — CID 110153267
2-ethoxy-N-[(1S,2S,3R,6S,8S)-2-hydroxy-1,6-dimethyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]-N-methylacetamide (PubChem CID 110153267) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-ethoxy-N-[(1S,2S,3R,6S,8S)-2-hydroxy-1,6-dimethyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]-N-methylacetamide.
| Compound Name | 2-ethoxy-N-[(1S,2S,3R,6S,8S)-2-hydroxy-1,6-dimethyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 110153267 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 2-ethoxy-N-[(1S,2S,3R,6S,8S)-2-hydroxy-1,6-dimethyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]-N-methylacetamide |
| SMILES | CCOCC(=O)N(C)[C@@H]1CC[C@@]2(C)C[C@H](c3ccccc3)C[C@](C)(O2)[C@H]1O |
| InChI | InChI=1S/C22H33NO4/c1-5-26-15-19(24)23(4)18-11-12-21(2)13-17(16-9-7-6-8-10-16)14-22(3,27-21)20(18)25/h6-10,17-18,20,25H,5,11-15H2,1-4H3/t17-,18+,20-,21-,22-/m0/s1 |
| InChIKey | DEIGJJRQDIQRTA-ITEKTMBMSA-N |
| XLogP | 3.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |