C25H37NO4 — CID 110153384
N-[(1S,2S,3R,6S,8S)-2-hydroxy-6-(2-hydroxyethyl)-1-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]cyclohexanecarboxamide (PubChem CID 110153384) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is N-[(1S,2S,3R,6S,8S)-2-hydroxy-6-(2-hydroxyethyl)-1-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(1S,2S,3R,6S,8S)-2-hydroxy-6-(2-hydroxyethyl)-1-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110153384 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | N-[(1S,2S,3R,6S,8S)-2-hydroxy-6-(2-hydroxyethyl)-1-methyl-8-phenyl-10-oxabicyclo[4.3.1]decan-3-yl]cyclohexanecarboxamide |
| SMILES | C[C@]12C[C@@H](c3ccccc3)C[C@](CCO)(CC[C@@H](NC(=O)C3CCCCC3)[C@@H]1O)O2 |
| InChI | InChI=1S/C25H37NO4/c1-24-16-20(18-8-4-2-5-9-18)17-25(30-24,14-15-27)13-12-21(22(24)28)26-23(29)19-10-6-3-7-11-19/h2,4-5,8-9,19-22,27-28H,3,6-7,10-17H2,1H3,(H,26,29)/t20-,21-,22+,24+,25-/m1/s1 |
| InChIKey | SPVYKLFXSRPMQV-FQFZUICKSA-N |
| XLogP | 3.68 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |