C24H25O3PS — CID 11015409
[[(Z)-3,3-dimethyl-2-phenylsulfanylbut-1-enyl]-phenoxyphosphoryl]oxybenzene (PubChem CID 11015409) has the molecular formula C24H25O3PS and a molecular weight of 424.50 g/mol. Its IUPAC name is [[(Z)-3,3-dimethyl-2-phenylsulfanylbut-1-enyl]-phenoxyphosphoryl]oxybenzene.
| Compound Name | [[(Z)-3,3-dimethyl-2-phenylsulfanylbut-1-enyl]-phenoxyphosphoryl]oxybenzene |
|---|---|
| PubChem CID | 11015409 |
| Molecular Formula | C24H25O3PS |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [[(Z)-3,3-dimethyl-2-phenylsulfanylbut-1-enyl]-phenoxyphosphoryl]oxybenzene |
| SMILES | CC(C)(C)/C(=C/P(=O)(Oc1ccccc1)Oc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C24H25O3PS/c1-24(2,3)23(29-22-17-11-6-12-18-22)19-28(25,26-20-13-7-4-8-14-20)27-21-15-9-5-10-16-21/h4-19H,1-3H3/b23-19- |
| InChIKey | PDXVTHIFMYEIMP-NMWGTECJSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|