About (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide
(2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide (PubChem CID 175410669) has the molecular formula C31H27BrNO3P
and a molecular weight of 572.44 g/mol. Its IUPAC name is (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide.
Molecular Properties
| Compound Name | (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide |
| PubChem CID | 175410669 |
| Molecular Formula | C31H27BrNO3P |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide |
| SMILES | O=P(C=C(c1ccccc1)c1ccccc1)(Oc1ccccc1)Oc1ccccc1.[Br-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C26H21O3P.C5H5N.BrH/c27-30(28-24-17-9-3-10-18-24,29-25-19-11-4-12-20-25)21-26(22-13-5-1-6-14-22)23-15-7-2-8-16-23;1-2-4-6-5-3-1;/h1-21H;1-5H;1H |
| InChIKey | YSSULSRSQFJDFN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 49.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide?
The IUPAC name of (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide (CID 175410669) is (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide.
What is the SMILES notation for (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide?
The canonical SMILES for (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide is O=P(C=C(c1ccccc1)c1ccccc1)(Oc1ccccc1)Oc1ccccc1.[Br-].c1cc[nH+]cc1.
What is the InChIKey of (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide?
The InChIKey is YSSULSRSQFJDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21O3P.C5H5N.BrH/c27-30(28-24-17-9-3-10-18-24,29-25-19-11-4-12-20-25)21-26(22-13-5-1-6-14-22)23-15-7-2-8-16-23;1-2-4-6-5-3-1;/h1-21H;1-5H;1H.
What are the key properties of (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide?
(2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide has a molecular weight of 572.44 g/mol, XLogP of 4.93, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diphenoxyphosphoryl-1-phenylethenyl)benzene;pyridin-1-ium;bromide is sourced from PubChem (CID 175410669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).