C18H29N5O5 — CID 110154493
N-[(2S)-6-amino-1-[(3R,4R)-3-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methylpiperidin-1-yl]-1-oxohexan-2-yl]acetamide (PubChem CID 110154493) has the molecular formula C18H29N5O5 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[(2S)-6-amino-1-[(3R,4R)-3-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methylpiperidin-1-yl]-1-oxohexan-2-yl]acetamide.
| Compound Name | N-[(2S)-6-amino-1-[(3R,4R)-3-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methylpiperidin-1-yl]-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 110154493 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(2S)-6-amino-1-[(3R,4R)-3-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-4-methylpiperidin-1-yl]-1-oxohexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N1CC[C@@](C)(O)[C@H](n2ccc(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C18H29N5O5/c1-12(24)20-13(5-3-4-8-19)16(26)22-10-7-18(2,28)14(11-22)23-9-6-15(25)21-17(23)27/h6,9,13-14,28H,3-5,7-8,10-11,19H2,1-2H3,(H,20,24)(H,21,25,27)/t13-,14+,18+/m0/s1 |
| InChIKey | SWUPBCLXNPRDJW-PMUMKWKESA-N |
| XLogP | -1.31 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|