C20H27NO3 — CID 110155652
1-[(2R,3aR,7aS)-2-methyl-2-(phenoxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone (PubChem CID 110155652) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[(2R,3aR,7aS)-2-methyl-2-(phenoxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone.
| Compound Name | 1-[(2R,3aR,7aS)-2-methyl-2-(phenoxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 110155652 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[(2R,3aR,7aS)-2-methyl-2-(phenoxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-2-cyclopropylethanone |
| SMILES | C[C@]1(COc2ccccc2)C[C@@H]2CN(C(=O)CC3CC3)CC[C@@H]2O1 |
| InChI | InChI=1S/C20H27NO3/c1-20(14-23-17-5-3-2-4-6-17)12-16-13-21(10-9-18(16)24-20)19(22)11-15-7-8-15/h2-6,15-16,18H,7-14H2,1H3/t16-,18+,20-/m1/s1 |
| InChIKey | IAHORJHZJZZHRI-IMFGXOCKSA-N |
| XLogP | 3.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |