C19H22N4O3 — CID 110155932
[(2R,3aR,7aS)-2-methyl-2-(pyridin-3-yloxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-pyridazin-3-ylmethanone (PubChem CID 110155932) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is [(2R,3aR,7aS)-2-methyl-2-(pyridin-3-yloxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-pyridazin-3-ylmethanone.
| Compound Name | [(2R,3aR,7aS)-2-methyl-2-(pyridin-3-yloxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 110155932 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(2R,3aR,7aS)-2-methyl-2-(pyridin-3-yloxymethyl)-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-5-yl]-pyridazin-3-ylmethanone |
| SMILES | C[C@]1(COc2cccnc2)C[C@@H]2CN(C(=O)c3cccnn3)CC[C@@H]2O1 |
| InChI | InChI=1S/C19H22N4O3/c1-19(13-25-15-4-2-7-20-11-15)10-14-12-23(9-6-17(14)26-19)18(24)16-5-3-8-21-22-16/h2-5,7-8,11,14,17H,6,9-10,12-13H2,1H3/t14-,17+,19-/m1/s1 |
| InChIKey | VSVPMKADAYEMNK-DKSSEZFCSA-N |
| XLogP | 1.96 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |