C14H19NO4S — CID 110156522
(5S,9S)-7-(benzenesulfonyl)-9-methoxy-1-oxa-7-azaspiro[4.4]nonane (PubChem CID 110156522) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (5S,9S)-7-(benzenesulfonyl)-9-methoxy-1-oxa-7-azaspiro[4.4]nonane.
| Compound Name | (5S,9S)-7-(benzenesulfonyl)-9-methoxy-1-oxa-7-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 110156522 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (5S,9S)-7-(benzenesulfonyl)-9-methoxy-1-oxa-7-azaspiro[4.4]nonane |
| SMILES | CO[C@H]1CN(S(=O)(=O)c2ccccc2)C[C@@]12CCCO2 |
| InChI | InChI=1S/C14H19NO4S/c1-18-13-10-15(11-14(13)8-5-9-19-14)20(16,17)12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | XMPRTASGZWHSGH-KBPBESRZSA-N |
| XLogP | 1.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |