C21H23ClO4S2 — CID 11015657
(1S,5R)-3-(2-chloro-4-methylsulfonylbenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one (PubChem CID 11015657) has the molecular formula C21H23ClO4S2 and a molecular weight of 439.00 g/mol. Its IUPAC name is (1S,5R)-3-(2-chloro-4-methylsulfonylbenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1S,5R)-3-(2-chloro-4-methylsulfonylbenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 11015657 |
| Molecular Formula | C21H23ClO4S2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (1S,5R)-3-(2-chloro-4-methylsulfonylbenzoyl)-4-(3-methylbut-3-enylsulfanyl)bicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=C(C)CCSC1=C(C(=O)c2ccc(S(C)(=O)=O)cc2Cl)C(=O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C21H23ClO4S2/c1-12(2)8-9-27-21-14-5-4-13(10-14)19(23)18(21)20(24)16-7-6-15(11-17(16)22)28(3,25)26/h6-7,11,13-14H,1,4-5,8-10H2,2-3H3/t13-,14+/m0/s1 |
| InChIKey | QSNZIGGXGTVQEJ-UONOGXRCSA-N |
| XLogP | 4.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|