C20H21ClO4S2 — CID 139763677
4-but-3-en-2-ylsulfanyl-3-(2-chloro-4-methylsulfonylbenzoyl)bicyclo[3.2.1]oct-3-en-2-one (PubChem CID 139763677) has the molecular formula C20H21ClO4S2 and a molecular weight of 424.97 g/mol. Its IUPAC name is 4-but-3-en-2-ylsulfanyl-3-(2-chloro-4-methylsulfonylbenzoyl)bicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 4-but-3-en-2-ylsulfanyl-3-(2-chloro-4-methylsulfonylbenzoyl)bicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 139763677 |
| Molecular Formula | C20H21ClO4S2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 4-but-3-en-2-ylsulfanyl-3-(2-chloro-4-methylsulfonylbenzoyl)bicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=CC(C)SC1=C(C(=O)c2ccc(S(C)(=O)=O)cc2Cl)C(=O)C2CCC1C2 |
| InChI | InChI=1S/C20H21ClO4S2/c1-4-11(2)26-20-13-6-5-12(9-13)18(22)17(20)19(23)15-8-7-14(10-16(15)21)27(3,24)25/h4,7-8,10-13H,1,5-6,9H2,2-3H3 |
| InChIKey | GMERZTDWUOLTIU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|