C20H17ClO4S2 — CID 175842375
3-(2-chloro-4-methylsulfonylbenzoyl)-4-thiophen-2-ylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 175842375) has the molecular formula C20H17ClO4S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 3-(2-chloro-4-methylsulfonylbenzoyl)-4-thiophen-2-ylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 3-(2-chloro-4-methylsulfonylbenzoyl)-4-thiophen-2-ylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 175842375 |
| Molecular Formula | C20H17ClO4S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 3-(2-chloro-4-methylsulfonylbenzoyl)-4-thiophen-2-ylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2=C(c3cccs3)C3CCC(C3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C20H17ClO4S2/c1-27(24,25)13-6-7-14(15(21)10-13)20(23)18-17(16-3-2-8-26-16)11-4-5-12(9-11)19(18)22/h2-3,6-8,10-12H,4-5,9H2,1H3 |
| InChIKey | FOEKANTVJIECRX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|