C15H22N2O2 — CID 110157325
(1R,2S,3R,5R)-3-amino-5-phenoxy-2-pyrrolidin-1-ylcyclopentan-1-ol (PubChem CID 110157325) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-amino-5-phenoxy-2-pyrrolidin-1-ylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R,5R)-3-amino-5-phenoxy-2-pyrrolidin-1-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 110157325 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (1R,2S,3R,5R)-3-amino-5-phenoxy-2-pyrrolidin-1-ylcyclopentan-1-ol |
| SMILES | N[C@@H]1C[C@@H](Oc2ccccc2)[C@H](O)[C@H]1N1CCCC1 |
| InChI | InChI=1S/C15H22N2O2/c16-12-10-13(19-11-6-2-1-3-7-11)15(18)14(12)17-8-4-5-9-17/h1-3,6-7,12-15,18H,4-5,8-10,16H2/t12-,13-,14+,15+/m1/s1 |
| InChIKey | AQHUHVKZMBDHNX-KBXIAJHMSA-N |
| XLogP | 0.99 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |