C24H31F2N3O4 — CID 110158583
tert-butyl N-[(1R,2S,3R,4R)-4-(2,4-difluorophenoxy)-3-hydroxy-2-[methyl(2-pyridin-2-ylethyl)amino]cyclopentyl]carbamate (PubChem CID 110158583) has the molecular formula C24H31F2N3O4 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3R,4R)-4-(2,4-difluorophenoxy)-3-hydroxy-2-[methyl(2-pyridin-2-ylethyl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3R,4R)-4-(2,4-difluorophenoxy)-3-hydroxy-2-[methyl(2-pyridin-2-ylethyl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 110158583 |
| Molecular Formula | C24H31F2N3O4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | tert-butyl N-[(1R,2S,3R,4R)-4-(2,4-difluorophenoxy)-3-hydroxy-2-[methyl(2-pyridin-2-ylethyl)amino]cyclopentyl]carbamate |
| SMILES | CN(CCc1ccccn1)[C@@H]1[C@@H](O)[C@H](Oc2ccc(F)cc2F)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31F2N3O4/c1-24(2,3)33-23(31)28-18-14-20(32-19-9-8-15(25)13-17(19)26)22(30)21(18)29(4)12-10-16-7-5-6-11-27-16/h5-9,11,13,18,20-22,30H,10,12,14H2,1-4H3,(H,28,31)/t18-,20-,21+,22+/m1/s1 |
| InChIKey | BQCUCORAMIBOEO-YJMBLLCNSA-N |
| XLogP | 3.31 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |