C22H33N3O4 — CID 110160277
2-[2-[[(4aS,9aS)-4-methyl-3-oxo-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]-4-tert-butylphenoxy]acetamide (PubChem CID 110160277) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[2-[[(4aS,9aS)-4-methyl-3-oxo-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]-4-tert-butylphenoxy]acetamide.
| Compound Name | 2-[2-[[(4aS,9aS)-4-methyl-3-oxo-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]-4-tert-butylphenoxy]acetamide |
|---|---|
| PubChem CID | 110160277 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[2-[[(4aS,9aS)-4-methyl-3-oxo-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-7-yl]methyl]-4-tert-butylphenoxy]acetamide |
| SMILES | CN1C(=O)CO[C@H]2CCN(Cc3cc(C(C)(C)C)ccc3OCC(N)=O)CC[C@@H]21 |
| InChI | InChI=1S/C22H33N3O4/c1-22(2,3)16-5-6-18(28-13-20(23)26)15(11-16)12-25-9-7-17-19(8-10-25)29-14-21(27)24(17)4/h5-6,11,17,19H,7-10,12-14H2,1-4H3,(H2,23,26)/t17-,19-/m0/s1 |
| InChIKey | HZOAJJFQVCHJSI-HKUYNNGSSA-N |
| XLogP | 1.67 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |