C18H26N2O5 — CID 110164616
1-[(3R,4S,5R)-4,5-dihydroxy-3-morpholin-4-ylazepan-1-yl]-2-phenoxyethanone (PubChem CID 110164616) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-4,5-dihydroxy-3-morpholin-4-ylazepan-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[(3R,4S,5R)-4,5-dihydroxy-3-morpholin-4-ylazepan-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 110164616 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-[(3R,4S,5R)-4,5-dihydroxy-3-morpholin-4-ylazepan-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CC[C@@H](O)[C@@H](O)[C@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C18H26N2O5/c21-16-6-7-20(17(22)13-25-14-4-2-1-3-5-14)12-15(18(16)23)19-8-10-24-11-9-19/h1-5,15-16,18,21,23H,6-13H2/t15-,16-,18+/m1/s1 |
| InChIKey | WTKNQOXONPVBCB-NUJGCVRESA-N |
| XLogP | -0.28 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |